C10H16N4O4 — CID 66337140
hydrazinyl 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate (PubChem CID 66337140) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is hydrazinyl 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate.
| Compound Name | hydrazinyl 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate |
|---|---|
| PubChem CID | 66337140 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | hydrazinyl 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate |
| SMILES | NNOC(=O)CCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C10H16N4O4/c11-13-18-7(15)3-6-14-8(16)10(12-9(14)17)4-1-2-5-10/h13H,1-6,11H2,(H,12,17) |
| InChIKey | GNSDRKUXMKMJLP-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|