C11H20N4O4 — CID 66337876
hydrazinyl 3-(4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propanoate (PubChem CID 66337876) has the molecular formula C11H20N4O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is hydrazinyl 3-(4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propanoate.
| Compound Name | hydrazinyl 3-(4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 66337876 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | hydrazinyl 3-(4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propanoate |
| SMILES | CCCCC1(C)NC(=O)N(CCC(=O)ONN)C1=O |
| InChI | InChI=1S/C11H20N4O4/c1-3-4-6-11(2)9(17)15(10(18)13-11)7-5-8(16)19-14-12/h14H,3-7,12H2,1-2H3,(H,13,18) |
| InChIKey | OWENVLMNAQZADJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|