C17H20BrFN2O4 — CID 9487016
(4-bromo-2-fluorophenyl)methyl 2-[(4R)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 9487016) has the molecular formula C17H20BrFN2O4 and a molecular weight of 415.26 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl 2-[(4R)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl 2-[(4R)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 9487016 |
| Molecular Formula | C17H20BrFN2O4 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl 2-[(4R)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCCC[C@@]1(C)NC(=O)N(CC(=O)OCc2ccc(Br)cc2F)C1=O |
| InChI | InChI=1S/C17H20BrFN2O4/c1-3-4-7-17(2)15(23)21(16(24)20-17)9-14(22)25-10-11-5-6-12(18)8-13(11)19/h5-6,8H,3-4,7,9-10H2,1-2H3,(H,20,24)/t17-/m1/s1 |
| InChIKey | NXEFHQNBLWOFBV-QGZVFWFLSA-N |
| XLogP | 3.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|