C19H23F2N3O5 — CID 8571771
[(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-[(4R)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 8571771) has the molecular formula C19H23F2N3O5 and a molecular weight of 411.41 g/mol. Its IUPAC name is [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-[(4R)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-[(4R)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 8571771 |
| Molecular Formula | C19H23F2N3O5 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-[(4R)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCCC[C@@]1(C)NC(=O)N(CC(=O)O[C@@H](C)C(=O)Nc2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C19H23F2N3O5/c1-4-5-8-19(3)17(27)24(18(28)23-19)10-15(25)29-11(2)16(26)22-14-7-6-12(20)9-13(14)21/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,22,26)(H,23,28)/t11-,19+/m0/s1 |
| InChIKey | SZCIJVPLLJSJKC-JEOXALJRSA-N |
| XLogP | 2.34 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|