C18H21F2N3O5 — CID 9486078
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-[(4S)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 9486078) has the molecular formula C18H21F2N3O5 and a molecular weight of 397.38 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-[(4S)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-[(4S)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 9486078 |
| Molecular Formula | C18H21F2N3O5 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-[(4S)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCCC[C@]1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C18H21F2N3O5/c1-3-4-7-18(2)16(26)23(17(27)22-18)9-15(25)28-10-14(24)21-13-6-5-11(19)8-12(13)20/h5-6,8H,3-4,7,9-10H2,1-2H3,(H,21,24)(H,22,27)/t18-/m0/s1 |
| InChIKey | PCXTWMXJLARLOJ-SFHVURJKSA-N |
| XLogP | 1.95 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|