C9H16N4O3 — CID 63577196
3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propanehydrazide (PubChem CID 63577196) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propanehydrazide.
| Compound Name | 3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 63577196 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propanehydrazide |
| SMILES | CCC1(C)NC(=O)N(CCC(=O)NN)C1=O |
| InChI | InChI=1S/C9H16N4O3/c1-3-9(2)7(15)13(8(16)11-9)5-4-6(14)12-10/h3-5,10H2,1-2H3,(H,11,16)(H,12,14) |
| InChIKey | PTHYPPBWMGHXPZ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|