C9H17N3O2 — CID 18070377
3-(2-aminopropyl)-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 18070377) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-(2-aminopropyl)-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-(2-aminopropyl)-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18070377 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-(2-aminopropyl)-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCC1(C)NC(=O)N(CC(C)N)C1=O |
| InChI | InChI=1S/C9H17N3O2/c1-4-9(3)7(13)12(5-6(2)10)8(14)11-9/h6H,4-5,10H2,1-3H3,(H,11,14) |
| InChIKey | PJMHJVLFPRWQMW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|