C13H24N2O4 — CID 63629297
3-(3,3-diethoxypropyl)-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 63629297) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-(3,3-diethoxypropyl)-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-(3,3-diethoxypropyl)-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 63629297 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-(3,3-diethoxypropyl)-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCOC(CCN1C(=O)NC(C)(CC)C1=O)OCC |
| InChI | InChI=1S/C13H24N2O4/c1-5-13(4)11(16)15(12(17)14-13)9-8-10(18-6-2)19-7-3/h10H,5-9H2,1-4H3,(H,14,17) |
| InChIKey | GTDDRGMHKDEGPQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|