C10H18N4O3 — CID 99122564
3-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]propylurea (PubChem CID 99122564) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]propylurea.
| Compound Name | 3-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]propylurea |
|---|---|
| PubChem CID | 99122564 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 3-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]propylurea |
| SMILES | CC[C@]1(C)NC(=O)N(CCCNC(N)=O)C1=O |
| InChI | InChI=1S/C10H18N4O3/c1-3-10(2)7(15)14(9(17)13-10)6-4-5-12-8(11)16/h3-6H2,1-2H3,(H,13,17)(H3,11,12,16)/t10-/m0/s1 |
| InChIKey | IJWZAKWKGXVMGJ-JTQLQIEISA-N |
| XLogP | -0.23 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|