C18H31F3N6O2 — CID 109379216
N-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109379216) has the molecular formula C18H31F3N6O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is N-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109379216 |
| Molecular Formula | C18H31F3N6O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCC1(C)NC(=O)N(CCCN/C(=N\C)N2CCN(C(C)C(F)(F)F)CC2)C1=O |
| InChI | InChI=1S/C18H31F3N6O2/c1-5-17(3)14(28)27(16(29)24-17)8-6-7-23-15(22-4)26-11-9-25(10-12-26)13(2)18(19,20)21/h13H,5-12H2,1-4H3,(H,22,23)(H,24,29) |
| InChIKey | NPPPSKPJHREOAS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|