C19H33F3N6O2 — CID 109376781
N-ethyl-N'-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376781) has the molecular formula C19H33F3N6O2 and a molecular weight of 434.51 g/mol. Its IUPAC name is N-ethyl-N'-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376781 |
| Molecular Formula | C19H33F3N6O2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | N-ethyl-N'-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1C(=O)NC(C)(CC)C1=O)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H33F3N6O2/c1-5-18(4)15(29)28(17(30)25-18)9-7-8-24-16(23-6-2)27-12-10-26(11-13-27)14(3)19(20,21)22/h14H,5-13H2,1-4H3,(H,23,24)(H,25,30) |
| InChIKey | TZFSNORAEYMYHA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|