C19H38IN5O2 — CID 111782092
1-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-3-heptan-2-ylguanidine;hydroiodide (PubChem CID 111782092) has the molecular formula C19H38IN5O2 and a molecular weight of 495.45 g/mol. Its IUPAC name is 1-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-3-heptan-2-ylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-3-heptan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111782092 |
| Molecular Formula | C19H38IN5O2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-3-heptan-2-ylguanidine;hydroiodide |
| SMILES | CCCCCC(C)N/C(=N/CCCN1C(=O)NC(C)(CC)C1=O)NCC.I |
| InChI | InChI=1S/C19H37N5O2.HI/c1-6-9-10-12-15(4)22-17(20-8-3)21-13-11-14-24-16(25)19(5,7-2)23-18(24)26;/h15H,6-14H2,1-5H3,(H,23,26)(H2,20,21,22);1H |
| InChIKey | SKMCARAAOWKVJL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|