C14H28IN5O2 — CID 111121565
1,3-diethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111121565) has the molecular formula C14H28IN5O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 1,3-diethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1,3-diethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111121565 |
| Molecular Formula | C14H28IN5O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1,3-diethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCNC(=NCCCN1C(=O)NC(C)(CC)C1=O)NCC.I |
| InChI | InChI=1S/C14H27N5O2.HI/c1-5-14(4)11(20)19(13(21)18-14)10-8-9-17-12(15-6-2)16-7-3;/h5-10H2,1-4H3,(H,18,21)(H2,15,16,17);1H |
| InChIKey | KKCDDUGFGSBRHU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|