C20H38N6O2 — CID 111785005
1-[3-(azepan-1-yl)propyl]-3-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methylguanidine (PubChem CID 111785005) has the molecular formula C20H38N6O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)propyl]-3-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[3-(azepan-1-yl)propyl]-3-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111785005 |
| Molecular Formula | C20H38N6O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 1-[3-(azepan-1-yl)propyl]-3-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methylguanidine |
| SMILES | CCC1(C)NC(=O)N(CCCN/C(=N\C)NCCCN2CCCCCC2)C1=O |
| InChI | InChI=1S/C20H38N6O2/c1-4-20(2)17(27)26(19(28)24-20)16-10-12-23-18(21-3)22-11-9-15-25-13-7-5-6-8-14-25/h4-16H2,1-3H3,(H,24,28)(H2,21,22,23) |
| InChIKey | QMZUIHOBRJWRNJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|