C22H36N6O2 — CID 111785203
1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methylguanidine (PubChem CID 111785203) has the molecular formula C22H36N6O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111785203 |
| Molecular Formula | C22H36N6O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 1-[2-(N-ethyl-3-methylanilino)ethyl]-3-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methylguanidine |
| SMILES | CCN(CCN/C(=N/C)NCCCN1C(=O)NC(C)(CC)C1=O)c1cccc(C)c1 |
| InChI | InChI=1S/C22H36N6O2/c1-6-22(4)19(29)28(21(30)26-22)14-9-12-24-20(23-5)25-13-15-27(7-2)18-11-8-10-17(3)16-18/h8,10-11,16H,6-7,9,12-15H2,1-5H3,(H,26,30)(H2,23,24,25) |
| InChIKey | VJMHRDXKIPTBJB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|