C16H26IN5O2S — CID 111783478
1-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111783478) has the molecular formula C16H26IN5O2S and a molecular weight of 479.39 g/mol. Its IUPAC name is 1-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111783478 |
| Molecular Formula | C16H26IN5O2S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 1-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCC1(C)NC(=O)N(CCCN/C(=N/C)NCc2cccs2)C1=O.I |
| InChI | InChI=1S/C16H25N5O2S.HI/c1-4-16(2)13(22)21(15(23)20-16)9-6-8-18-14(17-3)19-11-12-7-5-10-24-12;/h5,7,10H,4,6,8-9,11H2,1-3H3,(H,20,23)(H2,17,18,19);1H |
| InChIKey | CYUQKDOIUHRINI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|