C19H27F3IN5O2 — CID 111783692
1-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111783692) has the molecular formula C19H27F3IN5O2 and a molecular weight of 541.36 g/mol. Its IUPAC name is 1-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111783692 |
| Molecular Formula | C19H27F3IN5O2 |
| Molecular Weight | 541.36 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 1-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCC1(C)NC(=O)N(CCCN/C(=N\C)NCc2cccc(C(F)(F)F)c2)C1=O.I |
| InChI | InChI=1S/C19H26F3N5O2.HI/c1-4-18(2)15(28)27(17(29)26-18)10-6-9-24-16(23-3)25-12-13-7-5-8-14(11-13)19(20,21)22;/h5,7-8,11H,4,6,9-10,12H2,1-3H3,(H,26,29)(H2,23,24,25);1H |
| InChIKey | BFDNDQZYWPIFNV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|