C15H27N5O2 — CID 136926217
1-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-3-prop-2-enylguanidine (PubChem CID 136926217) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-3-prop-2-enylguanidine.
| Compound Name | 1-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136926217 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/CCCN1C(=O)NC(C)(CC)C1=O)NCC |
| InChI | InChI=1S/C15H27N5O2/c1-5-9-17-13(16-7-3)18-10-8-11-20-12(21)15(4,6-2)19-14(20)22/h5H,1,6-11H2,2-4H3,(H,19,22)(H2,16,17,18) |
| InChIKey | UILMYWBNVWFKSP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|