C11H19N5O2 — CID 136922386
2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-1-ethyl-3-prop-2-enylguanidine (PubChem CID 136922386) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-1-ethyl-3-prop-2-enylguanidine.
| Compound Name | 2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-1-ethyl-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136922386 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-1-ethyl-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/CCN1C(=O)CNC1=O)NCC |
| InChI | InChI=1S/C11H19N5O2/c1-3-5-13-10(12-4-2)14-6-7-16-9(17)8-15-11(16)18/h3H,1,4-8H2,2H3,(H,15,18)(H2,12,13,14) |
| InChIKey | YBBNGBWBIQMGJO-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|