C12H24IN5O3 — CID 111826339
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine;hydroiodide (PubChem CID 111826339) has the molecular formula C12H24IN5O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111826339 |
| Molecular Formula | C12H24IN5O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC)NCCN1C(=O)CNC1=O.I |
| InChI | InChI=1S/C12H23N5O3.HI/c1-3-13-11(14-5-4-8-20-2)15-6-7-17-10(18)9-16-12(17)19;/h3-9H2,1-2H3,(H,16,19)(H2,13,14,15);1H |
| InChIKey | BNYGIERBZZLDSR-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|