C12H24IN5O — CID 110975814
1-ethyl-3-(2-imidazol-1-ylethyl)-2-(3-methoxypropyl)guanidine;hydroiodide (PubChem CID 110975814) has the molecular formula C12H24IN5O and a molecular weight of 381.26 g/mol. Its IUPAC name is 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(3-methoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(3-methoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110975814 |
| Molecular Formula | C12H24IN5O |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-ethyl-3-(2-imidazol-1-ylethyl)-2-(3-methoxypropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC)NCCn1ccnc1.I |
| InChI | InChI=1S/C12H23N5O.HI/c1-3-14-12(15-5-4-10-18-2)16-7-9-17-8-6-13-11-17;/h6,8,11H,3-5,7,9-10H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | YLTUYGPFTGQYGK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|