C11H22N6O — CID 116514877
1-amino-2-(3-ethoxypropyl)-3-(2-imidazol-1-ylethyl)guanidine (PubChem CID 116514877) has the molecular formula C11H22N6O and a molecular weight of 254.34 g/mol. Its IUPAC name is 1-amino-2-(3-ethoxypropyl)-3-(2-imidazol-1-ylethyl)guanidine.
| Compound Name | 1-amino-2-(3-ethoxypropyl)-3-(2-imidazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 116514877 |
| Molecular Formula | C11H22N6O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-amino-2-(3-ethoxypropyl)-3-(2-imidazol-1-ylethyl)guanidine |
| SMILES | CCOCCC/N=C(\NN)NCCn1ccnc1 |
| InChI | InChI=1S/C11H22N6O/c1-2-18-9-3-4-14-11(16-12)15-6-8-17-7-5-13-10-17/h5,7,10H,2-4,6,8-9,12H2,1H3,(H2,14,15,16) |
| InChIKey | IHPSYHNYCHXMEV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|