C16H33IN6O — CID 111652093
1-ethyl-2-(3-imidazol-1-ylpropyl)-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111652093) has the molecular formula C16H33IN6O and a molecular weight of 452.39 g/mol. Its IUPAC name is 1-ethyl-2-(3-imidazol-1-ylpropyl)-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-imidazol-1-ylpropyl)-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111652093 |
| Molecular Formula | C16H33IN6O |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-ethyl-2-(3-imidazol-1-ylpropyl)-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1ccnc1)NCCN(C)CCCOC.I |
| InChI | InChI=1S/C16H32N6O.HI/c1-4-18-16(19-7-5-11-22-13-8-17-15-22)20-9-12-21(2)10-6-14-23-3;/h8,13,15H,4-7,9-12,14H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | KFCDESLLIUZANN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|