C17H24FN5S — CID 111311382
1-ethyl-2-[3-(4-fluorophenyl)sulfanylpropyl]-3-(2-imidazol-1-ylethyl)guanidine (PubChem CID 111311382) has the molecular formula C17H24FN5S and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-ethyl-2-[3-(4-fluorophenyl)sulfanylpropyl]-3-(2-imidazol-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[3-(4-fluorophenyl)sulfanylpropyl]-3-(2-imidazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111311382 |
| Molecular Formula | C17H24FN5S |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-ethyl-2-[3-(4-fluorophenyl)sulfanylpropyl]-3-(2-imidazol-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCCSc1ccc(F)cc1)NCCn1ccnc1 |
| InChI | InChI=1S/C17H24FN5S/c1-2-20-17(22-10-12-23-11-9-19-14-23)21-8-3-13-24-16-6-4-15(18)5-7-16/h4-7,9,11,14H,2-3,8,10,12-13H2,1H3,(H2,20,21,22) |
| InChIKey | NRYYYOIGKONZPK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|