C23H29N5 — CID 111233809
2-(3,3-diphenylpropyl)-1-ethyl-3-(2-imidazol-1-ylethyl)guanidine (PubChem CID 111233809) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-(3,3-diphenylpropyl)-1-ethyl-3-(2-imidazol-1-ylethyl)guanidine.
| Compound Name | 2-(3,3-diphenylpropyl)-1-ethyl-3-(2-imidazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111233809 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 2-(3,3-diphenylpropyl)-1-ethyl-3-(2-imidazol-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCC(c1ccccc1)c1ccccc1)NCCn1ccnc1 |
| InChI | InChI=1S/C23H29N5/c1-2-25-23(27-16-18-28-17-15-24-19-28)26-14-13-22(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,15,17,19,22H,2,13-14,16,18H2,1H3,(H2,25,26,27) |
| InChIKey | ZNIGFCZNKMYIKH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|