C16H28IN5O2 — CID 111828774
2-[2-(cyclohexen-1-yl)ethyl]-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111828774) has the molecular formula C16H28IN5O2 and a molecular weight of 449.34 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethyl]-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethyl]-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111828774 |
| Molecular Formula | C16H28IN5O2 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethyl]-1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCCCC1)NCCN1C(=O)CNC1=O.I |
| InChI | InChI=1S/C16H27N5O2.HI/c1-2-17-15(18-9-8-13-6-4-3-5-7-13)19-10-11-21-14(22)12-20-16(21)23;/h6H,2-5,7-12H2,1H3,(H,20,23)(H2,17,18,19);1H |
| InChIKey | WAROFUXVNAWKNX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|