C15H27F6IN4 — CID 109379373
N-ethyl-N'-(5,5,5-trifluoropentyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109379373) has the molecular formula C15H27F6IN4 and a molecular weight of 504.30 g/mol. Its IUPAC name is N-ethyl-N'-(5,5,5-trifluoropentyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(5,5,5-trifluoropentyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109379373 |
| Molecular Formula | C15H27F6IN4 |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | N-ethyl-N'-(5,5,5-trifluoropentyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCC(F)(F)F)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H26F6N4.HI/c1-3-22-13(23-7-5-4-6-14(16,17)18)25-10-8-24(9-11-25)12(2)15(19,20)21;/h12H,3-11H2,1-2H3,(H,22,23);1H |
| InChIKey | PLXAIRXUCNYBKY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|