C19H39F3IN5 — CID 109378827
N'-[7-(dimethylamino)heptyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109378827) has the molecular formula C19H39F3IN5 and a molecular weight of 521.45 g/mol. Its IUPAC name is N'-[7-(dimethylamino)heptyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[7-(dimethylamino)heptyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109378827 |
| Molecular Formula | C19H39F3IN5 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | N'-[7-(dimethylamino)heptyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCCCCN(C)C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C19H38F3N5.HI/c1-5-23-18(24-11-9-7-6-8-10-12-25(3)4)27-15-13-26(14-16-27)17(2)19(20,21)22;/h17H,5-16H2,1-4H3,(H,23,24);1H |
| InChIKey | LOUMZNLHNOXNDS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|