C13H26F3N5O2S — CID 109376225
N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376225) has the molecular formula C13H26F3N5O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376225 |
| Molecular Formula | C13H26F3N5O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H26F3N5O2S/c1-4-24(22,23)19-6-5-18-12(17-3)21-9-7-20(8-10-21)11(2)13(14,15)16/h11,19H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | KSXXJUGKYUGASC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|