C16H26F3N5O2S2 — CID 109379198
N'-methyl-N-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109379198) has the molecular formula C16H26F3N5O2S2 and a molecular weight of 441.55 g/mol. Its IUPAC name is N'-methyl-N-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109379198 |
| Molecular Formula | C16H26F3N5O2S2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N'-methyl-N-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCN(C)S(=O)(=O)c1cccs1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H26F3N5O2S2/c1-13(16(17,18)19)23-8-10-24(11-9-23)15(20-2)21-6-7-22(3)28(25,26)14-5-4-12-27-14/h4-5,12-13H,6-11H2,1-3H3,(H,20,21) |
| InChIKey | PDOSOKJEZVTSTB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|