C21H30F3N5O — CID 109378910
N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378910) has the molecular formula C21H30F3N5O and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378910 |
| Molecular Formula | C21H30F3N5O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCCC(=O)N1Cc2ccccc2C1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H30F3N5O/c1-16(21(22,23)24)27-10-12-28(13-11-27)20(25-2)26-9-5-8-19(30)29-14-17-6-3-4-7-18(17)15-29/h3-4,6-7,16H,5,8-15H2,1-2H3,(H,25,26) |
| InChIKey | DVMWZNQVCZYJNL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|