C18H32F3IN4O2 — CID 109377022
cyclopentyl 4-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]butanoate;hydroiodide (PubChem CID 109377022) has the molecular formula C18H32F3IN4O2 and a molecular weight of 520.38 g/mol. Its IUPAC name is cyclopentyl 4-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]butanoate;hydroiodide.
| Compound Name | cyclopentyl 4-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 109377022 |
| Molecular Formula | C18H32F3IN4O2 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | cyclopentyl 4-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]butanoate;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)OC1CCCC1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H31F3N4O2.HI/c1-14(18(19,20)21)24-10-12-25(13-11-24)17(22-2)23-9-5-8-16(26)27-15-6-3-4-7-15;/h14-15H,3-13H2,1-2H3,(H,22,23);1H |
| InChIKey | DXXROJFUBGDHJT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|