C19H28F3N5O — CID 109378990
N-[3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propyl]benzamide (PubChem CID 109378990) has the molecular formula C19H28F3N5O and a molecular weight of 399.46 g/mol. Its IUPAC name is N-[3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propyl]benzamide.
| Compound Name | N-[3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 109378990 |
| Molecular Formula | C19H28F3N5O |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propyl]benzamide |
| SMILES | C/N=C(\NCCCNC(=O)c1ccccc1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H28F3N5O/c1-15(19(20,21)22)26-11-13-27(14-12-26)18(23-2)25-10-6-9-24-17(28)16-7-4-3-5-8-16/h3-5,7-8,15H,6,9-14H2,1-2H3,(H,23,25)(H,24,28) |
| InChIKey | VQSSLMCEWZYDCE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|