C17H25F3N6O — CID 109378687
N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 109378687) has the molecular formula C17H25F3N6O and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109378687 |
| Molecular Formula | C17H25F3N6O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | C/N=C(\NCCNC(=O)c1cccnc1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H25F3N6O/c1-13(17(18,19)20)25-8-10-26(11-9-25)16(21-2)24-7-6-23-15(27)14-4-3-5-22-12-14/h3-5,12-13H,6-11H2,1-2H3,(H,21,24)(H,23,27) |
| InChIKey | HMKRBFDVVYZHCE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|