C16H25F3IN5 — CID 109378113
N'-methyl-N-(2-pyridin-3-ylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109378113) has the molecular formula C16H25F3IN5 and a molecular weight of 471.31 g/mol. Its IUPAC name is N'-methyl-N-(2-pyridin-3-ylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-(2-pyridin-3-ylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109378113 |
| Molecular Formula | C16H25F3IN5 |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N'-methyl-N-(2-pyridin-3-ylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1cccnc1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C16H24F3N5.HI/c1-13(16(17,18)19)23-8-10-24(11-9-23)15(20-2)22-7-5-14-4-3-6-21-12-14;/h3-4,6,12-13H,5,7-11H2,1-2H3,(H,20,22);1H |
| InChIKey | NKCIPKDAKJDYCS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|