C15H24F3IN4S — CID 109376586
N'-methyl-N-[(3-methylthiophen-2-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109376586) has the molecular formula C15H24F3IN4S and a molecular weight of 476.35 g/mol. Its IUPAC name is N'-methyl-N-[(3-methylthiophen-2-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(3-methylthiophen-2-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109376586 |
| Molecular Formula | C15H24F3IN4S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | N'-methyl-N-[(3-methylthiophen-2-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1sccc1C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H23F3N4S.HI/c1-11-4-9-23-13(11)10-20-14(19-3)22-7-5-21(6-8-22)12(2)15(16,17)18;/h4,9,12H,5-8,10H2,1-3H3,(H,19,20);1H |
| InChIKey | POIFKHFPIOXHCR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|