C17H24F5IN4O — CID 109377526
N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109377526) has the molecular formula C17H24F5IN4O and a molecular weight of 522.30 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109377526 |
| Molecular Formula | C17H24F5IN4O |
| Molecular Weight | 522.30 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OC(F)F)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H23F5N4O.HI/c1-12(17(20,21)22)25-7-9-26(10-8-25)16(23-2)24-11-13-5-3-4-6-14(13)27-15(18)19;/h3-6,12,15H,7-11H2,1-2H3,(H,23,24);1H |
| InChIKey | PJUPPPBBHFKVER-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|