C18H26F2IN3O — CID 109443868
N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109443868) has the molecular formula C18H26F2IN3O and a molecular weight of 465.33 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109443868 |
| Molecular Formula | C18H26F2IN3O |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OC(F)F)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C18H25F2N3O.HI/c1-21-18(23-11-14-7-2-3-8-15(14)12-23)22-10-13-6-4-5-9-16(13)24-17(19)20;/h4-6,9,14-15,17H,2-3,7-8,10-12H2,1H3,(H,21,22);1H |
| InChIKey | ILQKKLOYYCGGBZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|