C14H28F3N5 — CID 109379330
N-[2-[ethyl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109379330) has the molecular formula C14H28F3N5 and a molecular weight of 323.41 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-[ethyl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109379330 |
| Molecular Formula | C14H28F3N5 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN(C)CCN/C(=N\C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H28F3N5/c1-5-20(4)7-6-19-13(18-3)22-10-8-21(9-11-22)12(2)14(15,16)17/h12H,5-11H2,1-4H3,(H,18,19) |
| InChIKey | GSAOCJDXJYOEED-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|