C8H14N2O3 — CID 130653587
3-ethoxy-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 130653587) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-ethoxy-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-ethoxy-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130653587 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 3-ethoxy-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCON1C(=O)NC(C)(CC)C1=O |
| InChI | InChI=1S/C8H14N2O3/c1-4-8(3)6(11)10(13-5-2)7(12)9-8/h4-5H2,1-3H3,(H,9,12) |
| InChIKey | MFPRSGDSGPGYGU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|