About 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione
1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione (PubChem CID 64967932) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione.
Molecular Properties
| Compound Name | 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione |
| PubChem CID | 64967932 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione |
| SMILES | CCOCC(C)N1CCC(=O)NC(C)(CC)C1=O |
| InChI | InChI=1S/C13H24N2O3/c1-5-13(4)12(17)15(8-7-11(16)14-13)10(3)9-18-6-2/h10H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | QSPBMTOSOSVBBR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione?
The IUPAC name of 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione (CID 64967932) is 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione.
What is the SMILES notation for 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione?
The canonical SMILES for 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione is CCOCC(C)N1CCC(=O)NC(C)(CC)C1=O.
What is the InChIKey of 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione?
The InChIKey is QSPBMTOSOSVBBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3/c1-5-13(4)12(17)15(8-7-11(16)14-13)10(3)9-18-6-2/h10H,5-9H2,1-4H3,(H,14,16).
What are the key properties of 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione?
1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione has a molecular weight of 256.35 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethoxypropan-2-yl)-3-ethyl-3-methyl-1,4-diazepane-2,5-dione is sourced from PubChem (CID 64967932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).