C6H10N2O2S2 — CID 137384358
(5R)-3-(disulfanyl)-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 137384358) has the molecular formula C6H10N2O2S2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (5R)-3-(disulfanyl)-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-(disulfanyl)-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137384358 |
| Molecular Formula | C6H10N2O2S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | (5R)-3-(disulfanyl)-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C)NC(=O)N(SS)C1=O |
| InChI | InChI=1S/C6H10N2O2S2/c1-3-6(2)4(9)8(12-11)5(10)7-6/h11H,3H2,1-2H3,(H,7,10)/t6-/m1/s1 |
| InChIKey | MFVXLVKWRLIBMM-ZCFIWIBFSA-N |
| XLogP | 1.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|