C15H28N2O2 — CID 134243919
(5R)-5-ethyl-5-methyl-3-nonan-2-ylimidazolidine-2,4-dione (PubChem CID 134243919) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (5R)-5-ethyl-5-methyl-3-nonan-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-methyl-3-nonan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134243919 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (5R)-5-ethyl-5-methyl-3-nonan-2-ylimidazolidine-2,4-dione |
| SMILES | CCCCCCCC(C)N1C(=O)N[C@](C)(CC)C1=O |
| InChI | InChI=1S/C15H28N2O2/c1-5-7-8-9-10-11-12(3)17-13(18)15(4,6-2)16-14(17)19/h12H,5-11H2,1-4H3,(H,16,19)/t12?,15-/m1/s1 |
| InChIKey | BOLWREBHQFFTGP-WPZCJLIBSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|