C27H51N3O2 — CID 163447732
1,5-di(heptan-2-yl)-6-methylidene-3-nonan-2-yl-1,3,5-triazinane-2,4-dione (PubChem CID 163447732) has the molecular formula C27H51N3O2 and a molecular weight of 449.72 g/mol. Its IUPAC name is 1,5-di(heptan-2-yl)-6-methylidene-3-nonan-2-yl-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,5-di(heptan-2-yl)-6-methylidene-3-nonan-2-yl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 163447732 |
| Molecular Formula | C27H51N3O2 |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.40 |
| IUPAC Name | 1,5-di(heptan-2-yl)-6-methylidene-3-nonan-2-yl-1,3,5-triazinane-2,4-dione |
| SMILES | C=C1N(C(C)CCCCC)C(=O)N(C(C)CCCCCCC)C(=O)N1C(C)CCCCC |
| InChI | InChI=1S/C27H51N3O2/c1-8-11-14-15-18-21-24(6)30-26(31)28(22(4)19-16-12-9-2)25(7)29(27(30)32)23(5)20-17-13-10-3/h22-24H,7-21H2,1-6H3 |
| InChIKey | BDXUZKQWYDDCGT-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|