C8H11FN2O4 — CID 81297119
2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-fluoroacetic acid (PubChem CID 81297119) has the molecular formula C8H11FN2O4 and a molecular weight of 218.18 g/mol. Its IUPAC name is 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-fluoroacetic acid.
| Compound Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-fluoroacetic acid |
|---|---|
| PubChem CID | 81297119 |
| Molecular Formula | C8H11FN2O4 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-fluoroacetic acid |
| SMILES | CCC1(C)NC(=O)N(C(F)C(=O)O)C1=O |
| InChI | InChI=1S/C8H11FN2O4/c1-3-8(2)6(14)11(7(15)10-8)4(9)5(12)13/h4H,3H2,1-2H3,(H,10,15)(H,12,13) |
| InChIKey | HVJPQWIATNHTBT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|