C10H16N2O4 — CID 82028835
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-methylbutanoic acid (PubChem CID 82028835) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-methylbutanoic acid.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 82028835 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C10H16N2O4/c1-5(2)6(7(13)14)12-8(15)10(3,4)11-9(12)16/h5-6H,1-4H3,(H,11,16)(H,13,14) |
| InChIKey | RWBOFBUXELOWBT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|