C11H16N2O4 — CID 11402201
(2S)-3-cyclopropyl-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid (PubChem CID 11402201) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (2S)-3-cyclopropyl-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid.
| Compound Name | (2S)-3-cyclopropyl-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 11402201 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (2S)-3-cyclopropyl-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid |
| SMILES | CC1(C)NC(=O)N([C@@H](CC2CC2)C(=O)O)C1=O |
| InChI | InChI=1S/C11H16N2O4/c1-11(2)9(16)13(10(17)12-11)7(8(14)15)5-6-3-4-6/h6-7H,3-5H2,1-2H3,(H,12,17)(H,14,15)/t7-/m0/s1 |
| InChIKey | DRTRYKVUCQVYFN-ZETCQYMHSA-N |
| XLogP | 0.57 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|