C8H14N2O6 — CID 173212284
3-[bis(hydroxymethoxy)methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 173212284) has the molecular formula C8H14N2O6 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-[bis(hydroxymethoxy)methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[bis(hydroxymethoxy)methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 173212284 |
| Molecular Formula | C8H14N2O6 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-[bis(hydroxymethoxy)methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(C(OCO)OCO)C1=O |
| InChI | InChI=1S/C8H14N2O6/c1-8(2)5(13)10(6(14)9-8)7(15-3-11)16-4-12/h7,11-12H,3-4H2,1-2H3,(H,9,14) |
| InChIKey | YBBVXLQUAMGNHS-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|