C7H12N2O6 — CID 174913705
1,3-bis(hydroxymethoxy)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 174913705) has the molecular formula C7H12N2O6 and a molecular weight of 220.18 g/mol. Its IUPAC name is 1,3-bis(hydroxymethoxy)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1,3-bis(hydroxymethoxy)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174913705 |
| Molecular Formula | C7H12N2O6 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 1,3-bis(hydroxymethoxy)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(OCO)C(=O)N1OCO |
| InChI | InChI=1S/C7H12N2O6/c1-7(2)5(12)8(14-3-10)6(13)9(7)15-4-11/h10-11H,3-4H2,1-2H3 |
| InChIKey | SPGIBJJMLUJJDB-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|