C16H26N2O8 — CID 23732289
ethyl 2-[[3-(2-ethoxy-2-oxoethoxy)-2,2,5,5-tetramethyl-4,6-dioxo-1,3-diazinan-1-yl]oxy]acetate (PubChem CID 23732289) has the molecular formula C16H26N2O8 and a molecular weight of 374.39 g/mol. Its IUPAC name is ethyl 2-[[3-(2-ethoxy-2-oxoethoxy)-2,2,5,5-tetramethyl-4,6-dioxo-1,3-diazinan-1-yl]oxy]acetate.
| Compound Name | ethyl 2-[[3-(2-ethoxy-2-oxoethoxy)-2,2,5,5-tetramethyl-4,6-dioxo-1,3-diazinan-1-yl]oxy]acetate |
|---|---|
| PubChem CID | 23732289 |
| Molecular Formula | C16H26N2O8 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | ethyl 2-[[3-(2-ethoxy-2-oxoethoxy)-2,2,5,5-tetramethyl-4,6-dioxo-1,3-diazinan-1-yl]oxy]acetate |
| SMILES | CCOC(=O)CON1C(=O)C(C)(C)C(=O)N(OCC(=O)OCC)C1(C)C |
| InChI | InChI=1S/C16H26N2O8/c1-7-23-11(19)9-25-17-13(21)15(3,4)14(22)18(16(17,5)6)26-10-12(20)24-8-2/h7-10H2,1-6H3 |
| InChIKey | IGBCEOWZZXHYJH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|